About 1-hydroxypropyl acetate
1-hydroxypropyl acetate (PubChem CID 21275092) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is 1-hydroxypropyl acetate.
Molecular Properties
| Compound Name | 1-hydroxypropyl acetate |
| PubChem CID | 21275092 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | 1-hydroxypropyl acetate |
| SMILES | CCC(O)OC(C)=O |
| InChI | InChI=1S/C5H10O3/c1-3-5(7)8-4(2)6/h5,7H,3H2,1-2H3 |
| InChIKey | VEGXEWGKYMMJKP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropyl acetate?
The IUPAC name of 1-hydroxypropyl acetate (CID 21275092) is 1-hydroxypropyl acetate.
What is the SMILES notation for 1-hydroxypropyl acetate?
The canonical SMILES for 1-hydroxypropyl acetate is CCC(O)OC(C)=O.
What is the InChIKey of 1-hydroxypropyl acetate?
The InChIKey is VEGXEWGKYMMJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3/c1-3-5(7)8-4(2)6/h5,7H,3H2,1-2H3.
What are the key properties of 1-hydroxypropyl acetate?
1-hydroxypropyl acetate has a molecular weight of 118.13 g/mol, XLogP of 0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropyl acetate is sourced from PubChem (CID 21275092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).