About CID 59628409
CID 59628409 (PubChem CID 59628409) has the molecular formula C6H11BO3
and a molecular weight of 141.96 g/mol.
Molecular Properties
| Compound Name | CID 59628409 |
| PubChem CID | 59628409 |
| Molecular Formula | C6H11BO3 |
| Molecular Weight | 141.96 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | — |
| SMILES | [B]C(OC(C)=O)C(O)CC |
| InChI | InChI=1S/C6H11BO3/c1-3-5(9)6(7)10-4(2)8/h5-6,9H,3H2,1-2H3 |
| InChIKey | PODBDCZXMYOREB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.96 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59628409 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59628409?
The IUPAC name of CID 59628409 (CID 59628409) is not available.
What is the SMILES notation for CID 59628409?
The canonical SMILES for CID 59628409 is [B]C(OC(C)=O)C(O)CC.
What is the InChIKey of CID 59628409?
The InChIKey is PODBDCZXMYOREB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BO3/c1-3-5(9)6(7)10-4(2)8/h5-6,9H,3H2,1-2H3.
What are the key properties of CID 59628409?
CID 59628409 has a molecular weight of 141.96 g/mol, XLogP of -0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59628409 is sourced from PubChem (CID 59628409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).