About 3-hydroxyhexadecan-4-yl acetate
3-hydroxyhexadecan-4-yl acetate (PubChem CID 59845354) has the molecular formula C18H36O3
and a molecular weight of 300.48 g/mol. Its IUPAC name is 3-hydroxyhexadecan-4-yl acetate.
Molecular Properties
| Compound Name | 3-hydroxyhexadecan-4-yl acetate |
| PubChem CID | 59845354 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 3-hydroxyhexadecan-4-yl acetate |
| SMILES | CCCCCCCCCCCCC(OC(C)=O)C(O)CC |
| InChI | InChI=1S/C18H36O3/c1-4-6-7-8-9-10-11-12-13-14-15-18(17(20)5-2)21-16(3)19/h17-18,20H,4-15H2,1-3H3 |
| InChIKey | JIVLPHGAMRZPCH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyhexadecan-4-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyhexadecan-4-yl acetate?
The IUPAC name of 3-hydroxyhexadecan-4-yl acetate (CID 59845354) is 3-hydroxyhexadecan-4-yl acetate.
What is the SMILES notation for 3-hydroxyhexadecan-4-yl acetate?
The canonical SMILES for 3-hydroxyhexadecan-4-yl acetate is CCCCCCCCCCCCC(OC(C)=O)C(O)CC.
What is the InChIKey of 3-hydroxyhexadecan-4-yl acetate?
The InChIKey is JIVLPHGAMRZPCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O3/c1-4-6-7-8-9-10-11-12-13-14-15-18(17(20)5-2)21-16(3)19/h17-18,20H,4-15H2,1-3H3.
What are the key properties of 3-hydroxyhexadecan-4-yl acetate?
3-hydroxyhexadecan-4-yl acetate has a molecular weight of 300.48 g/mol, XLogP of 5.00, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyhexadecan-4-yl acetate is sourced from PubChem (CID 59845354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).