C23H44O4 — CID 173087659
1,2-dihydroxyhenicos-12-en-3-yl acetate (PubChem CID 173087659) has the molecular formula C23H44O4 and a molecular weight of 384.60 g/mol. Its IUPAC name is 1,2-dihydroxyhenicos-12-en-3-yl acetate.
| Compound Name | 1,2-dihydroxyhenicos-12-en-3-yl acetate |
|---|---|
| PubChem CID | 173087659 |
| Molecular Formula | C23H44O4 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | 1,2-dihydroxyhenicos-12-en-3-yl acetate |
| SMILES | CCCCCCCCC=CCCCCCCCCC(OC(C)=O)C(O)CO |
| InChI | InChI=1S/C23H44O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(22(26)20-24)27-21(2)25/h10-11,22-24,26H,3-9,12-20H2,1-2H3 |
| InChIKey | KXYGROWXEMBMON-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|