C23H42O5 — CID 87186714
[(Z)-1,3-dihydroxy-4-oxohenicos-12-en-2-yl] acetate (PubChem CID 87186714) has the molecular formula C23H42O5 and a molecular weight of 398.58 g/mol. Its IUPAC name is [(Z)-1,3-dihydroxy-4-oxohenicos-12-en-2-yl] acetate.
| Compound Name | [(Z)-1,3-dihydroxy-4-oxohenicos-12-en-2-yl] acetate |
|---|---|
| PubChem CID | 87186714 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | [(Z)-1,3-dihydroxy-4-oxohenicos-12-en-2-yl] acetate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(O)C(CO)OC(C)=O |
| InChI | InChI=1S/C23H42O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(26)23(27)22(19-24)28-20(2)25/h10-11,22-24,27H,3-9,12-19H2,1-2H3/b11-10- |
| InChIKey | PANLOOWAZBGKDV-KHPPLWFESA-N |
| XLogP | 4.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|