C23H42O5 — CID 24741444
[(2R)-2-acetyloxy-3-hydroxypropyl] (Z)-octadec-9-enoate (PubChem CID 24741444) has the molecular formula C23H42O5 and a molecular weight of 398.58 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-hydroxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [(2R)-2-acetyloxy-3-hydroxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 24741444 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | [(2R)-2-acetyloxy-3-hydroxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](CO)OC(C)=O |
| InChI | InChI=1S/C23H42O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(26)27-20-22(19-24)28-21(2)25/h10-11,22,24H,3-9,12-20H2,1-2H3/b11-10-/t22-/m1/s1 |
| InChIKey | PWTCCMJTPHCGMS-GMAFFVFYSA-N |
| XLogP | 5.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|