About 1-acetyloxytetradecyl acetate
1-acetyloxytetradecyl acetate (PubChem CID 88785738) has the molecular formula C18H34O4
and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-acetyloxytetradecyl acetate.
Molecular Properties
| Compound Name | 1-acetyloxytetradecyl acetate |
| PubChem CID | 88785738 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 1-acetyloxytetradecyl acetate |
| SMILES | CCCCCCCCCCCCCC(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C18H34O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-18(21-16(2)19)22-17(3)20/h18H,4-15H2,1-3H3 |
| InChIKey | IRJRCSMEYRDYDF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-acetyloxytetradecyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyloxytetradecyl acetate?
The IUPAC name of 1-acetyloxytetradecyl acetate (CID 88785738) is 1-acetyloxytetradecyl acetate.
What is the SMILES notation for 1-acetyloxytetradecyl acetate?
The canonical SMILES for 1-acetyloxytetradecyl acetate is CCCCCCCCCCCCCC(OC(C)=O)OC(C)=O.
What is the InChIKey of 1-acetyloxytetradecyl acetate?
The InChIKey is IRJRCSMEYRDYDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-18(21-16(2)19)22-17(3)20/h18H,4-15H2,1-3H3.
What are the key properties of 1-acetyloxytetradecyl acetate?
1-acetyloxytetradecyl acetate has a molecular weight of 314.47 g/mol, XLogP of 5.14, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyloxytetradecyl acetate is sourced from PubChem (CID 88785738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).