About 1-hydroxytetradecyl acetate
1-hydroxytetradecyl acetate (PubChem CID 6365614) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-hydroxytetradecyl acetate.
Molecular Properties
| Compound Name | 1-hydroxytetradecyl acetate |
| PubChem CID | 6365614 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 1-hydroxytetradecyl acetate |
| SMILES | CCCCCCCCCCCCCC(O)OC(C)=O |
| InChI | InChI=1S/C16H32O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-16(18)19-15(2)17/h16,18H,3-14H2,1-2H3 |
| InChIKey | PXIJHDFUUKDQMU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxytetradecyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxytetradecyl acetate?
The IUPAC name of 1-hydroxytetradecyl acetate (CID 6365614) is 1-hydroxytetradecyl acetate.
What is the SMILES notation for 1-hydroxytetradecyl acetate?
The canonical SMILES for 1-hydroxytetradecyl acetate is CCCCCCCCCCCCCC(O)OC(C)=O.
What is the InChIKey of 1-hydroxytetradecyl acetate?
The InChIKey is PXIJHDFUUKDQMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-16(18)19-15(2)17/h16,18H,3-14H2,1-2H3.
What are the key properties of 1-hydroxytetradecyl acetate?
1-hydroxytetradecyl acetate has a molecular weight of 272.43 g/mol, XLogP of 4.57, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxytetradecyl acetate is sourced from PubChem (CID 6365614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).