About 1-iododecyl acetate
1-iododecyl acetate (PubChem CID 155063034) has the molecular formula C12H23IO2
and a molecular weight of 326.22 g/mol. Its IUPAC name is 1-iododecyl acetate.
Molecular Properties
| Compound Name | 1-iododecyl acetate |
| PubChem CID | 155063034 |
| Molecular Formula | C12H23IO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 1-iododecyl acetate |
| SMILES | CCCCCCCCCC(I)OC(C)=O |
| InChI | InChI=1S/C12H23IO2/c1-3-4-5-6-7-8-9-10-12(13)15-11(2)14/h12H,3-10H2,1-2H3 |
| InChIKey | LYEQYJROYQKGRW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iododecyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iododecyl acetate?
The IUPAC name of 1-iododecyl acetate (CID 155063034) is 1-iododecyl acetate.
What is the SMILES notation for 1-iododecyl acetate?
The canonical SMILES for 1-iododecyl acetate is CCCCCCCCCC(I)OC(C)=O.
What is the InChIKey of 1-iododecyl acetate?
The InChIKey is LYEQYJROYQKGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23IO2/c1-3-4-5-6-7-8-9-10-12(13)15-11(2)14/h12H,3-10H2,1-2H3.
What are the key properties of 1-iododecyl acetate?
1-iododecyl acetate has a molecular weight of 326.22 g/mol, XLogP of 4.45, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iododecyl acetate is sourced from PubChem (CID 155063034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).