About 1-iodotridecyl prop-2-enoate
1-iodotridecyl prop-2-enoate (PubChem CID 90218413) has the molecular formula C16H29IO2
and a molecular weight of 380.31 g/mol. Its IUPAC name is 1-iodotridecyl prop-2-enoate.
Molecular Properties
| Compound Name | 1-iodotridecyl prop-2-enoate |
| PubChem CID | 90218413 |
| Molecular Formula | C16H29IO2 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-iodotridecyl prop-2-enoate |
| SMILES | C=CC(=O)OC(I)CCCCCCCCCCCC |
| InChI | InChI=1S/C16H29IO2/c1-3-5-6-7-8-9-10-11-12-13-14-15(17)19-16(18)4-2/h4,15H,2-3,5-14H2,1H3 |
| InChIKey | CPLPGGMINZFKHS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-iodotridecyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodotridecyl prop-2-enoate?
The IUPAC name of 1-iodotridecyl prop-2-enoate (CID 90218413) is 1-iodotridecyl prop-2-enoate.
What is the SMILES notation for 1-iodotridecyl prop-2-enoate?
The canonical SMILES for 1-iodotridecyl prop-2-enoate is C=CC(=O)OC(I)CCCCCCCCCCCC.
What is the InChIKey of 1-iodotridecyl prop-2-enoate?
The InChIKey is CPLPGGMINZFKHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29IO2/c1-3-5-6-7-8-9-10-11-12-13-14-15(17)19-16(18)4-2/h4,15H,2-3,5-14H2,1H3.
What are the key properties of 1-iodotridecyl prop-2-enoate?
1-iodotridecyl prop-2-enoate has a molecular weight of 380.31 g/mol, XLogP of 5.79, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodotridecyl prop-2-enoate is sourced from PubChem (CID 90218413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).