About [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate
[(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate (PubChem CID 175255491) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate |
| PubChem CID | 175255491 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate |
| SMILES | CC[C@@H](O)OC(=O)N1CCCC1 |
| InChI | InChI=1S/C8H15NO3/c1-2-7(10)12-8(11)9-5-3-4-6-9/h7,10H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | UMDLYODXKDOZFG-ZETCQYMHSA-N |
| XLogP | 0.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate?
The IUPAC name of [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate (CID 175255491) is [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate.
What is the SMILES notation for [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate?
The canonical SMILES for [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate is CC[C@@H](O)OC(=O)N1CCCC1.
What is the InChIKey of [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate?
The InChIKey is UMDLYODXKDOZFG-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H15NO3/c1-2-7(10)12-8(11)9-5-3-4-6-9/h7,10H,2-6H2,1H3/t7-/m0/s1.
What are the key properties of [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate?
[(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate has a molecular weight of 173.21 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-hydroxypropyl] pyrrolidine-1-carboxylate is sourced from PubChem (CID 175255491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).