About 1-propoxypropan-1-ol;hydrate
1-propoxypropan-1-ol;hydrate (PubChem CID 174406445) has the molecular formula C6H16O3
and a molecular weight of 136.19 g/mol. Its IUPAC name is 1-propoxypropan-1-ol;hydrate.
Molecular Properties
| Compound Name | 1-propoxypropan-1-ol;hydrate |
| PubChem CID | 174406445 |
| Molecular Formula | C6H16O3 |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.11 |
| IUPAC Name | 1-propoxypropan-1-ol;hydrate |
| SMILES | CCCOC(O)CC.O |
| InChI | InChI=1S/C6H14O2.H2O/c1-3-5-8-6(7)4-2;/h6-7H,3-5H2,1-2H3;1H2 |
| InChIKey | QOBBKRZJMDQRNU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 60.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-propoxypropan-1-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propoxypropan-1-ol;hydrate?
The IUPAC name of 1-propoxypropan-1-ol;hydrate (CID 174406445) is 1-propoxypropan-1-ol;hydrate.
What is the SMILES notation for 1-propoxypropan-1-ol;hydrate?
The canonical SMILES for 1-propoxypropan-1-ol;hydrate is CCCOC(O)CC.O.
What is the InChIKey of 1-propoxypropan-1-ol;hydrate?
The InChIKey is QOBBKRZJMDQRNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.H2O/c1-3-5-8-6(7)4-2;/h6-7H,3-5H2,1-2H3;1H2.
What are the key properties of 1-propoxypropan-1-ol;hydrate?
1-propoxypropan-1-ol;hydrate has a molecular weight of 136.19 g/mol, XLogP of 0.32, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propoxypropan-1-ol;hydrate is sourced from PubChem (CID 174406445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).