About 1-butoxyethanol;1-butoxypropan-1-ol
1-butoxyethanol;1-butoxypropan-1-ol (PubChem CID 161420365) has the molecular formula C13H30O4
and a molecular weight of 250.38 g/mol. Its IUPAC name is 1-butoxyethanol;1-butoxypropan-1-ol.
Molecular Properties
| Compound Name | 1-butoxyethanol;1-butoxypropan-1-ol |
| PubChem CID | 161420365 |
| Molecular Formula | C13H30O4 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | 1-butoxyethanol;1-butoxypropan-1-ol |
| SMILES | CCCCOC(C)O.CCCCOC(O)CC |
| InChI | InChI=1S/C7H16O2.C6H14O2/c1-3-5-6-9-7(8)4-2;1-3-4-5-8-6(2)7/h7-8H,3-6H2,1-2H3;6-7H,3-5H2,1-2H3 |
| InChIKey | VWQNMPVFXFQEAP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxyethanol;1-butoxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxyethanol;1-butoxypropan-1-ol?
The IUPAC name of 1-butoxyethanol;1-butoxypropan-1-ol (CID 161420365) is 1-butoxyethanol;1-butoxypropan-1-ol.
What is the SMILES notation for 1-butoxyethanol;1-butoxypropan-1-ol?
The canonical SMILES for 1-butoxyethanol;1-butoxypropan-1-ol is CCCCOC(C)O.CCCCOC(O)CC.
What is the InChIKey of 1-butoxyethanol;1-butoxypropan-1-ol?
The InChIKey is VWQNMPVFXFQEAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2.C6H14O2/c1-3-5-6-9-7(8)4-2;1-3-4-5-8-6(2)7/h7-8H,3-6H2,1-2H3;6-7H,3-5H2,1-2H3.
What are the key properties of 1-butoxyethanol;1-butoxypropan-1-ol?
1-butoxyethanol;1-butoxypropan-1-ol has a molecular weight of 250.38 g/mol, XLogP of 2.67, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxyethanol;1-butoxypropan-1-ol is sourced from PubChem (CID 161420365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).