About magnesium;hydride;1-propoxyethanol
magnesium;hydride;1-propoxyethanol (PubChem CID 174529104) has the molecular formula C5H14MgO2
and a molecular weight of 130.47 g/mol. Its IUPAC name is magnesium;hydride;1-propoxyethanol.
Molecular Properties
| Compound Name | magnesium;hydride;1-propoxyethanol |
| PubChem CID | 174529104 |
| Molecular Formula | C5H14MgO2 |
| Molecular Weight | 130.47 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | magnesium;hydride;1-propoxyethanol |
| SMILES | CCCOC(C)O.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C5H12O2.Mg.2H/c1-3-4-7-5(2)6;;;/h5-6H,3-4H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | OVFMFUMJXKIWQN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.47 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze magnesium;hydride;1-propoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;hydride;1-propoxyethanol?
The IUPAC name of magnesium;hydride;1-propoxyethanol (CID 174529104) is magnesium;hydride;1-propoxyethanol.
What is the SMILES notation for magnesium;hydride;1-propoxyethanol?
The canonical SMILES for magnesium;hydride;1-propoxyethanol is CCCOC(C)O.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;hydride;1-propoxyethanol?
The InChIKey is OVFMFUMJXKIWQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.Mg.2H/c1-3-4-7-5(2)6;;;/h5-6H,3-4H2,1-2H3;;;/q;+2;2*-1.
What are the key properties of magnesium;hydride;1-propoxyethanol?
magnesium;hydride;1-propoxyethanol has a molecular weight of 130.47 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hydride;1-propoxyethanol is sourced from PubChem (CID 174529104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).