C11H24O2 — CID 88960137
(3S)-3,4-dimethyl-1-propoxyhexan-1-ol (PubChem CID 88960137) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is (3S)-3,4-dimethyl-1-propoxyhexan-1-ol.
| Compound Name | (3S)-3,4-dimethyl-1-propoxyhexan-1-ol |
|---|---|
| PubChem CID | 88960137 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | (3S)-3,4-dimethyl-1-propoxyhexan-1-ol |
| SMILES | CCCOC(O)C[C@H](C)C(C)CC |
| InChI | InChI=1S/C11H24O2/c1-5-7-13-11(12)8-10(4)9(3)6-2/h9-12H,5-8H2,1-4H3/t9?,10-,11?/m0/s1 |
| InChIKey | SCTXLVCFCJNWPW-YVNMAJEFSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|