C12H28 — CID 142268679
ethane;2,4,5-trimethylheptane (PubChem CID 142268679) has the molecular formula C12H28 and a molecular weight of 172.36 g/mol. Its IUPAC name is ethane;2,4,5-trimethylheptane.
| Compound Name | ethane;2,4,5-trimethylheptane |
|---|---|
| PubChem CID | 142268679 |
| Molecular Formula | C12H28 |
| Molecular Weight | 172.36 g/mol |
| Exact Mass | 172.22 |
| IUPAC Name | ethane;2,4,5-trimethylheptane |
| SMILES | CC.CCC(C)C(C)CC(C)C |
| InChI | InChI=1S/C10H22.C2H6/c1-6-9(4)10(5)7-8(2)3;1-2/h8-10H,6-7H2,1-5H3;1-2H3 |
| InChIKey | HKOSZQQHZCFPQA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |