About CID 91437014
CID 91437014 (PubChem CID 91437014) has the molecular formula C8H18S2
and a molecular weight of 178.37 g/mol.
Molecular Properties
| Compound Name | CID 91437014 |
| PubChem CID | 91437014 |
| Molecular Formula | C8H18S2 |
| Molecular Weight | 178.37 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | — |
| SMILES | CCC(C)C(C)CC.S=S |
| InChI | InChI=1S/C8H18.S2/c1-5-7(3)8(4)6-2;1-2/h7-8H,5-6H2,1-4H3; |
| InChIKey | ZKSWOAFQAJSXSX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 91437014 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91437014?
The IUPAC name of CID 91437014 (CID 91437014) is not available.
What is the SMILES notation for CID 91437014?
The canonical SMILES for CID 91437014 is CCC(C)C(C)CC.S=S.
What is the InChIKey of CID 91437014?
The InChIKey is ZKSWOAFQAJSXSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.S2/c1-5-7(3)8(4)6-2;1-2/h7-8H,5-6H2,1-4H3;.
What are the key properties of CID 91437014?
CID 91437014 has a molecular weight of 178.37 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91437014 is sourced from PubChem (CID 91437014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).