C6H13I — CID 88913110
(2S,3S)-2-iodo-3-methylpentane (PubChem CID 88913110) has the molecular formula C6H13I and a molecular weight of 212.07 g/mol. Its IUPAC name is (2S,3S)-2-iodo-3-methylpentane.
| Compound Name | (2S,3S)-2-iodo-3-methylpentane |
|---|---|
| PubChem CID | 88913110 |
| Molecular Formula | C6H13I |
| Molecular Weight | 212.07 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | (2S,3S)-2-iodo-3-methylpentane |
| SMILES | CC[C@H](C)[C@H](C)I |
| InChI | InChI=1S/C6H13I/c1-4-5(2)6(3)7/h5-6H,4H2,1-3H3/t5-,6-/m0/s1 |
| InChIKey | MHIYXLPYCSGBRG-WDSKDSINSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.07 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|