C30H62 — CID 168768999
3,4,5,6,7,8,9,10,11,12,13,14,15-tridecamethylheptadecane (PubChem CID 168768999) has the molecular formula C30H62 and a molecular weight of 422.83 g/mol. Its IUPAC name is 3,4,5,6,7,8,9,10,11,12,13,14,15-tridecamethylheptadecane.
| Compound Name | 3,4,5,6,7,8,9,10,11,12,13,14,15-tridecamethylheptadecane |
|---|---|
| PubChem CID | 168768999 |
| Molecular Formula | C30H62 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.49 |
| IUPAC Name | 3,4,5,6,7,8,9,10,11,12,13,14,15-tridecamethylheptadecane |
| SMILES | CCC(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)CC |
| InChI | InChI=1S/C30H62/c1-16-18(3)20(5)22(7)24(9)26(11)28(13)30(15)29(14)27(12)25(10)23(8)21(6)19(4)17-2/h18-30H,16-17H2,1-15H3 |
| InChIKey | JRJHMBCBDSHSSS-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |