C41H82 — CID 123401956
3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19-heptadecamethylhenicosan-2-ylcyclopropane (PubChem CID 123401956) has the molecular formula C41H82 and a molecular weight of 575.11 g/mol. Its IUPAC name is 3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19-heptadecamethylhenicosan-2-ylcyclopropane.
| Compound Name | 3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19-heptadecamethylhenicosan-2-ylcyclopropane |
|---|---|
| PubChem CID | 123401956 |
| Molecular Formula | C41H82 |
| Molecular Weight | 575.11 g/mol |
| Exact Mass | 574.64 |
| IUPAC Name | 3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19-heptadecamethylhenicosan-2-ylcyclopropane |
| SMILES | CCC(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C1CC1 |
| InChI | InChI=1S/C41H82/c1-20-23(2)24(3)25(4)26(5)27(6)28(7)29(8)30(9)31(10)32(11)33(12)34(13)35(14)36(15)37(16)38(17)39(18)40(19)41-21-22-41/h23-41H,20-22H2,1-19H3 |
| InChIKey | BRSZYFOGBHHDFO-UHFFFAOYSA-N |
| XLogP | 13.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.11 |
| LogP ≤ 5 | 13.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |