About 1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane
1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane (PubChem CID 123142246) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is 1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane.
Analyze 1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane?
The IUPAC name of 1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane (CID 123142246) is 1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane.
What is the SMILES notation for 1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane?
The canonical SMILES for 1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane is CCC(C)C(C)C(C)C(C)C1CC1CC.
What is the InChIKey of 1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane?
The InChIKey is OKZSZVVBYLZFNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30/c1-7-10(3)11(4)12(5)13(6)15-9-14(15)8-2/h10-15H,7-9H2,1-6H3.
What are the key properties of 1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane?
1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane has a molecular weight of 210.40 g/mol, XLogP of 4.99, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-(3,4,5-trimethylheptan-2-yl)cyclopropane is sourced from PubChem (CID 123142246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).