carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane

C9H16O2 — CID 158990668

IUPACcarbon dioxide;1-ethyl-2-propan-2-ylcyclopropane
SMILESCCC1CC1C(C)C.O=C=O
InChIInChI=1S/C8H16.CO2/c1-4-7-5-8(7)6(2)3;2-1-3/h6-8H,4-5H2,1-3H3;
InChIKeyJQCVXAPWZLVNKS-UHFFFAOYSA-N
MW156.22 g/mol
LogP2.11
Rot. Bonds2

About carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane

carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane (PubChem CID 158990668) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane.

Molecular Properties

Compound Namecarbon dioxide;1-ethyl-2-propan-2-ylcyclopropane
PubChem CID158990668
Molecular FormulaC9H16O2
Molecular Weight156.22 g/mol
Exact Mass156.12
IUPAC Namecarbon dioxide;1-ethyl-2-propan-2-ylcyclopropane
SMILESCCC1CC1C(C)C.O=C=O
InChIInChI=1S/C8H16.CO2/c1-4-7-5-8(7)6(2)3;2-1-3/h6-8H,4-5H2,1-3H3;
InChIKeyJQCVXAPWZLVNKS-UHFFFAOYSA-N
XLogP2.11
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.22
LogP ≤ 52.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane?
The IUPAC name of carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane (CID 158990668) is carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane.
What is the SMILES notation for carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane?
The canonical SMILES for carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane is CCC1CC1C(C)C.O=C=O.
What is the InChIKey of carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane?
The InChIKey is JQCVXAPWZLVNKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.CO2/c1-4-7-5-8(7)6(2)3;2-1-3/h6-8H,4-5H2,1-3H3;.
What are the key properties of carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane?
carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane has a molecular weight of 156.22 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;1-ethyl-2-propan-2-ylcyclopropane is sourced from PubChem (CID 158990668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).