About 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane
1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane (PubChem CID 142876952) has the molecular formula C16H34
and a molecular weight of 226.45 g/mol. Its IUPAC name is 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane.
Molecular Properties
| Compound Name | 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane |
| PubChem CID | 142876952 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane |
| SMILES | CC.CCC1CC(C)C(C(C)C)CC1CC |
| InChI | InChI=1S/C14H28.C2H6/c1-6-12-8-11(5)14(10(3)4)9-13(12)7-2;1-2/h10-14H,6-9H2,1-5H3;1-2H3 |
| InChIKey | ZZMNODLQAKLRBG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane?
The IUPAC name of 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane (CID 142876952) is 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane.
What is the SMILES notation for 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane?
The canonical SMILES for 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane is CC.CCC1CC(C)C(C(C)C)CC1CC.
What is the InChIKey of 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane?
The InChIKey is ZZMNODLQAKLRBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28.C2H6/c1-6-12-8-11(5)14(10(3)4)9-13(12)7-2;1-2/h10-14H,6-9H2,1-5H3;1-2H3.
What are the key properties of 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane?
1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane has a molecular weight of 226.45 g/mol, XLogP of 5.77, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethyl-4-methyl-5-propan-2-ylcyclohexane;ethane is sourced from PubChem (CID 142876952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).