C16H30 — CID 123639406
2-(3,4,5-trimethylheptan-2-yl)bicyclo[2.2.0]hexane (PubChem CID 123639406) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 2-(3,4,5-trimethylheptan-2-yl)bicyclo[2.2.0]hexane.
| Compound Name | 2-(3,4,5-trimethylheptan-2-yl)bicyclo[2.2.0]hexane |
|---|---|
| PubChem CID | 123639406 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 2-(3,4,5-trimethylheptan-2-yl)bicyclo[2.2.0]hexane |
| SMILES | CCC(C)C(C)C(C)C(C)C1CC2CCC21 |
| InChI | InChI=1S/C16H30/c1-6-10(2)11(3)12(4)13(5)16-9-14-7-8-15(14)16/h10-16H,6-9H2,1-5H3 |
| InChIKey | KHQCQCGDKRXVNB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |