C32H66 — CID 59966829
3,4,5,6,7,8,9,10,11,12,13,14,16-tridecamethylnonadecane (PubChem CID 59966829) has the molecular formula C32H66 and a molecular weight of 450.88 g/mol. Its IUPAC name is 3,4,5,6,7,8,9,10,11,12,13,14,16-tridecamethylnonadecane.
| Compound Name | 3,4,5,6,7,8,9,10,11,12,13,14,16-tridecamethylnonadecane |
|---|---|
| PubChem CID | 59966829 |
| Molecular Formula | C32H66 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.52 |
| IUPAC Name | 3,4,5,6,7,8,9,10,11,12,13,14,16-tridecamethylnonadecane |
| SMILES | CCCC(C)CC(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)C(C)CC |
| InChI | InChI=1S/C32H66/c1-16-18-20(3)19-22(5)24(7)26(9)28(11)30(13)32(15)31(14)29(12)27(10)25(8)23(6)21(4)17-2/h20-32H,16-19H2,1-15H3 |
| InChIKey | AYJVMZNZLNOYKK-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |