About 3,6-dimethylnonan-4-ol
3,6-dimethylnonan-4-ol (PubChem CID 56626033) has the molecular formula C11H24O
and a molecular weight of 172.31 g/mol. Its IUPAC name is 3,6-dimethylnonan-4-ol.
Molecular Properties
| Compound Name | 3,6-dimethylnonan-4-ol |
| PubChem CID | 56626033 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 3,6-dimethylnonan-4-ol |
| SMILES | CCCC(C)CC(O)C(C)CC |
| InChI | InChI=1S/C11H24O/c1-5-7-9(3)8-11(12)10(4)6-2/h9-12H,5-8H2,1-4H3 |
| InChIKey | KFRPRHQVKQTVGX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6-dimethylnonan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethylnonan-4-ol?
The IUPAC name of 3,6-dimethylnonan-4-ol (CID 56626033) is 3,6-dimethylnonan-4-ol.
What is the SMILES notation for 3,6-dimethylnonan-4-ol?
The canonical SMILES for 3,6-dimethylnonan-4-ol is CCCC(C)CC(O)C(C)CC.
What is the InChIKey of 3,6-dimethylnonan-4-ol?
The InChIKey is KFRPRHQVKQTVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O/c1-5-7-9(3)8-11(12)10(4)6-2/h9-12H,5-8H2,1-4H3.
What are the key properties of 3,6-dimethylnonan-4-ol?
3,6-dimethylnonan-4-ol has a molecular weight of 172.31 g/mol, XLogP of 3.22, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethylnonan-4-ol is sourced from PubChem (CID 56626033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).