About (4R)-4-methylheptan-3-ol
(4R)-4-methylheptan-3-ol (PubChem CID 12799251) has the molecular formula C8H18O
and a molecular weight of 130.23 g/mol. Its IUPAC name is (4R)-4-methylheptan-3-ol.
Molecular Properties
| Compound Name | (4R)-4-methylheptan-3-ol |
| PubChem CID | 12799251 |
| Molecular Formula | C8H18O |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.14 |
| IUPAC Name | (4R)-4-methylheptan-3-ol |
| SMILES | CCC[C@@H](C)C(O)CC |
| InChI | InChI=1S/C8H18O/c1-4-6-7(3)8(9)5-2/h7-9H,4-6H2,1-3H3/t7-,8?/m1/s1 |
| InChIKey | BKQICAFAUMRYLZ-GVHYBUMESA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-4-methylheptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-methylheptan-3-ol?
The IUPAC name of (4R)-4-methylheptan-3-ol (CID 12799251) is (4R)-4-methylheptan-3-ol.
What is the SMILES notation for (4R)-4-methylheptan-3-ol?
The canonical SMILES for (4R)-4-methylheptan-3-ol is CCC[C@@H](C)C(O)CC.
What is the InChIKey of (4R)-4-methylheptan-3-ol?
The InChIKey is BKQICAFAUMRYLZ-GVHYBUMESA-N. The full InChI is InChI=1S/C8H18O/c1-4-6-7(3)8(9)5-2/h7-9H,4-6H2,1-3H3/t7-,8?/m1/s1.
What are the key properties of (4R)-4-methylheptan-3-ol?
(4R)-4-methylheptan-3-ol has a molecular weight of 130.23 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-methylheptan-3-ol is sourced from PubChem (CID 12799251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).