C9H20 — CID 59819300
(3R)-3,4-dimethylheptane (PubChem CID 59819300) has the molecular formula C9H20 and a molecular weight of 128.26 g/mol. Its IUPAC name is (3R)-3,4-dimethylheptane.
| Compound Name | (3R)-3,4-dimethylheptane |
|---|---|
| PubChem CID | 59819300 |
| Molecular Formula | C9H20 |
| Molecular Weight | 128.26 g/mol |
| Exact Mass | 128.16 |
| IUPAC Name | (3R)-3,4-dimethylheptane |
| SMILES | CCCC(C)[C@H](C)CC |
| InChI | InChI=1S/C9H20/c1-5-7-9(4)8(3)6-2/h8-9H,5-7H2,1-4H3/t8-,9?/m1/s1 |
| InChIKey | MAKRYGRRIKSDES-VEDVMXKPSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |