About CID 162262014
CID 162262014 (PubChem CID 162262014) has the molecular formula C13H28B2
and a molecular weight of 205.99 g/mol.
Molecular Properties
| Compound Name | CID 162262014 |
| PubChem CID | 162262014 |
| Molecular Formula | C13H28B2 |
| Molecular Weight | 205.99 g/mol |
| Exact Mass | 206.24 |
| IUPAC Name | — |
| SMILES | [B]CC(C)C(C)CC.[B]CC(C)CCC |
| InChI | InChI=1S/C7H15B.C6H13B/c1-4-6(2)7(3)5-8;1-3-4-6(2)5-7/h6-7H,4-5H2,1-3H3;6H,3-5H2,1-2H3 |
| InChIKey | SQCPGPOWVVKZBN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.99 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162262014 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162262014?
The IUPAC name of CID 162262014 (CID 162262014) is not available.
What is the SMILES notation for CID 162262014?
The canonical SMILES for CID 162262014 is [B]CC(C)C(C)CC.[B]CC(C)CCC.
What is the InChIKey of CID 162262014?
The InChIKey is SQCPGPOWVVKZBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15B.C6H13B/c1-4-6(2)7(3)5-8;1-3-4-6(2)5-7/h6-7H,4-5H2,1-3H3;6H,3-5H2,1-2H3.
What are the key properties of CID 162262014?
CID 162262014 has a molecular weight of 205.99 g/mol, XLogP of 4.26, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162262014 is sourced from PubChem (CID 162262014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).