About 4-methylheptane;propane
4-methylheptane;propane (PubChem CID 142171269) has the molecular formula C14H34
and a molecular weight of 202.43 g/mol. Its IUPAC name is 4-methylheptane;propane.
Molecular Properties
| Compound Name | 4-methylheptane;propane |
| PubChem CID | 142171269 |
| Molecular Formula | C14H34 |
| Molecular Weight | 202.43 g/mol |
| Exact Mass | 202.27 |
| IUPAC Name | 4-methylheptane;propane |
| SMILES | CCC.CCC.CCCC(C)CCC |
| InChI | InChI=1S/C8H18.2C3H8/c1-4-6-8(3)7-5-2;2*1-3-2/h8H,4-7H2,1-3H3;2*3H2,1-2H3 |
| InChIKey | FBVNRFYEMZFPFN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 202.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-methylheptane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylheptane;propane?
The IUPAC name of 4-methylheptane;propane (CID 142171269) is 4-methylheptane;propane.
What is the SMILES notation for 4-methylheptane;propane?
The canonical SMILES for 4-methylheptane;propane is CCC.CCC.CCCC(C)CCC.
What is the InChIKey of 4-methylheptane;propane?
The InChIKey is FBVNRFYEMZFPFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.2C3H8/c1-4-6-8(3)7-5-2;2*1-3-2/h8H,4-7H2,1-3H3;2*3H2,1-2H3.
What are the key properties of 4-methylheptane;propane?
4-methylheptane;propane has a molecular weight of 202.43 g/mol, XLogP of 6.06, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylheptane;propane is sourced from PubChem (CID 142171269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).