About acetylene;4-methylheptane
acetylene;4-methylheptane (PubChem CID 143164229) has the molecular formula C10H20
and a molecular weight of 140.27 g/mol. Its IUPAC name is acetylene;4-methylheptane.
Molecular Properties
| Compound Name | acetylene;4-methylheptane |
| PubChem CID | 143164229 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | acetylene;4-methylheptane |
| SMILES | C#C.CCCC(C)CCC |
| InChI | InChI=1S/C8H18.C2H2/c1-4-6-8(3)7-5-2;1-2/h8H,4-7H2,1-3H3;1-2H |
| InChIKey | DQJBMVNEXXWMIV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;4-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;4-methylheptane?
The IUPAC name of acetylene;4-methylheptane (CID 143164229) is acetylene;4-methylheptane.
What is the SMILES notation for acetylene;4-methylheptane?
The canonical SMILES for acetylene;4-methylheptane is C#C.CCCC(C)CCC.
What is the InChIKey of acetylene;4-methylheptane?
The InChIKey is DQJBMVNEXXWMIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C2H2/c1-4-6-8(3)7-5-2;1-2/h8H,4-7H2,1-3H3;1-2H.
What are the key properties of acetylene;4-methylheptane?
acetylene;4-methylheptane has a molecular weight of 140.27 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;4-methylheptane is sourced from PubChem (CID 143164229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).