About ethane;5-methyloct-1-en-4-ol
ethane;5-methyloct-1-en-4-ol (PubChem CID 142059047) has the molecular formula C11H24O
and a molecular weight of 172.31 g/mol. Its IUPAC name is ethane;5-methyloct-1-en-4-ol.
Molecular Properties
| Compound Name | ethane;5-methyloct-1-en-4-ol |
| PubChem CID | 142059047 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | ethane;5-methyloct-1-en-4-ol |
| SMILES | C=CCC(O)C(C)CCC.CC |
| InChI | InChI=1S/C9H18O.C2H6/c1-4-6-8(3)9(10)7-5-2;1-2/h5,8-10H,2,4,6-7H2,1,3H3;1-2H3 |
| InChIKey | COAYNRNFHYVHBS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-methyloct-1-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyloct-1-en-4-ol?
The IUPAC name of ethane;5-methyloct-1-en-4-ol (CID 142059047) is ethane;5-methyloct-1-en-4-ol.
What is the SMILES notation for ethane;5-methyloct-1-en-4-ol?
The canonical SMILES for ethane;5-methyloct-1-en-4-ol is C=CCC(O)C(C)CCC.CC.
What is the InChIKey of ethane;5-methyloct-1-en-4-ol?
The InChIKey is COAYNRNFHYVHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C2H6/c1-4-6-8(3)9(10)7-5-2;1-2/h5,8-10H,2,4,6-7H2,1,3H3;1-2H3.
What are the key properties of ethane;5-methyloct-1-en-4-ol?
ethane;5-methyloct-1-en-4-ol has a molecular weight of 172.31 g/mol, XLogP of 3.39, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyloct-1-en-4-ol is sourced from PubChem (CID 142059047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).