C7H14O2 — CID 130652300
(2R)-2-methylhex-5-ene-1,3-diol (PubChem CID 130652300) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is (2R)-2-methylhex-5-ene-1,3-diol.
| Compound Name | (2R)-2-methylhex-5-ene-1,3-diol |
|---|---|
| PubChem CID | 130652300 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (2R)-2-methylhex-5-ene-1,3-diol |
| SMILES | C=CCC(O)[C@H](C)CO |
| InChI | InChI=1S/C7H14O2/c1-3-4-7(9)6(2)5-8/h3,6-9H,1,4-5H2,2H3/t6-,7?/m1/s1 |
| InChIKey | XIOWAZGQENSIGN-ULUSZKPHSA-N |
| XLogP | 0.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|