C9H18O6 — CID 87557711
(2R,3R,4R,5S,6R)-non-8-ene-1,2,3,4,5,6-hexol (PubChem CID 87557711) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-non-8-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4R,5S,6R)-non-8-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 87557711 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2R,3R,4R,5S,6R)-non-8-ene-1,2,3,4,5,6-hexol |
| SMILES | C=CC[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H18O6/c1-2-3-5(11)7(13)9(15)8(14)6(12)4-10/h2,5-15H,1,3-4H2/t5-,6-,7+,8-,9-/m1/s1 |
| InChIKey | KOOBOEHYNRNKGC-SYHAXYEDSA-N |
| XLogP | -2.64 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|