C10H20O6 — CID 141460109
(2R,3R,4R,5S)-dec-8-ene-1,2,3,4,5,6-hexol (PubChem CID 141460109) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is (2R,3R,4R,5S)-dec-8-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4R,5S)-dec-8-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141460109 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (2R,3R,4R,5S)-dec-8-ene-1,2,3,4,5,6-hexol |
| SMILES | CC=CCC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H20O6/c1-2-3-4-6(12)8(14)10(16)9(15)7(13)5-11/h2-3,6-16H,4-5H2,1H3/t6?,7-,8+,9-,10-/m1/s1 |
| InChIKey | ALCQJSZYYDTOGN-JNSGDMPLSA-N |
| XLogP | -2.25 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|