C7H14O5 — CID 154708941
(2S,3S,4R,5S)-hept-6-ene-1,2,3,4,5-pentol (PubChem CID 154708941) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is (2S,3S,4R,5S)-hept-6-ene-1,2,3,4,5-pentol.
| Compound Name | (2S,3S,4R,5S)-hept-6-ene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 154708941 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (2S,3S,4R,5S)-hept-6-ene-1,2,3,4,5-pentol |
| SMILES | C=C[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C7H14O5/c1-2-4(9)6(11)7(12)5(10)3-8/h2,4-12H,1,3H2/t4-,5-,6+,7-/m0/s1 |
| InChIKey | UMUQPWGRCGSHKW-YTLHQDLWSA-N |
| XLogP | -2.39 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|