C7H14O3 — CID 13198343
3-prop-2-enylbutane-1,2,4-triol (PubChem CID 13198343) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-prop-2-enylbutane-1,2,4-triol.
| Compound Name | 3-prop-2-enylbutane-1,2,4-triol |
|---|---|
| PubChem CID | 13198343 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 3-prop-2-enylbutane-1,2,4-triol |
| SMILES | C=CCC(CO)C(O)CO |
| InChI | InChI=1S/C7H14O3/c1-2-3-6(4-8)7(10)5-9/h2,6-10H,1,3-5H2 |
| InChIKey | JCUGHNSSOSRNOG-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|