About 3-prop-2-enoxypentane-1,2,4,5-tetrol
3-prop-2-enoxypentane-1,2,4,5-tetrol (PubChem CID 142590945) has the molecular formula C8H16O5
and a molecular weight of 192.21 g/mol. Its IUPAC name is 3-prop-2-enoxypentane-1,2,4,5-tetrol.
Molecular Properties
| Compound Name | 3-prop-2-enoxypentane-1,2,4,5-tetrol |
| PubChem CID | 142590945 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 3-prop-2-enoxypentane-1,2,4,5-tetrol |
| SMILES | C=CCOC(C(O)CO)C(O)CO |
| InChI | InChI=1S/C8H16O5/c1-2-3-13-8(6(11)4-9)7(12)5-10/h2,6-12H,1,3-5H2 |
| InChIKey | ZXRYSEKIRIFSDJ-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enoxypentane-1,2,4,5-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enoxypentane-1,2,4,5-tetrol?
The IUPAC name of 3-prop-2-enoxypentane-1,2,4,5-tetrol (CID 142590945) is 3-prop-2-enoxypentane-1,2,4,5-tetrol.
What is the SMILES notation for 3-prop-2-enoxypentane-1,2,4,5-tetrol?
The canonical SMILES for 3-prop-2-enoxypentane-1,2,4,5-tetrol is C=CCOC(C(O)CO)C(O)CO.
What is the InChIKey of 3-prop-2-enoxypentane-1,2,4,5-tetrol?
The InChIKey is ZXRYSEKIRIFSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O5/c1-2-3-13-8(6(11)4-9)7(12)5-10/h2,6-12H,1,3-5H2.
What are the key properties of 3-prop-2-enoxypentane-1,2,4,5-tetrol?
3-prop-2-enoxypentane-1,2,4,5-tetrol has a molecular weight of 192.21 g/mol, XLogP of -1.74, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enoxypentane-1,2,4,5-tetrol is sourced from PubChem (CID 142590945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).