C12H22O5 — CID 57018640
3-(1,2-dihydroxyhex-5-en-3-yloxy)hex-5-ene-1,2-diol (PubChem CID 57018640) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is 3-(1,2-dihydroxyhex-5-en-3-yloxy)hex-5-ene-1,2-diol.
| Compound Name | 3-(1,2-dihydroxyhex-5-en-3-yloxy)hex-5-ene-1,2-diol |
|---|---|
| PubChem CID | 57018640 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-(1,2-dihydroxyhex-5-en-3-yloxy)hex-5-ene-1,2-diol |
| SMILES | C=CCC(OC(CC=C)C(O)CO)C(O)CO |
| InChI | InChI=1S/C12H22O5/c1-3-5-11(9(15)7-13)17-12(6-4-2)10(16)8-14/h3-4,9-16H,1-2,5-8H2 |
| InChIKey | YVCHZHMXHQIIAT-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|