C8H16O2 — CID 102243304
(2S,3S)-3-methylhept-6-ene-1,2-diol (PubChem CID 102243304) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is (2S,3S)-3-methylhept-6-ene-1,2-diol.
| Compound Name | (2S,3S)-3-methylhept-6-ene-1,2-diol |
|---|---|
| PubChem CID | 102243304 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (2S,3S)-3-methylhept-6-ene-1,2-diol |
| SMILES | C=CCC[C@H](C)[C@H](O)CO |
| InChI | InChI=1S/C8H16O2/c1-3-4-5-7(2)8(10)6-9/h3,7-10H,1,4-6H2,2H3/t7-,8+/m0/s1 |
| InChIKey | UAODWIAAWCTNGG-JGVFFNPUSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|