C9H18O2 — CID 103456684
2-methyloct-7-ene-3,4-diol (PubChem CID 103456684) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-methyloct-7-ene-3,4-diol.
| Compound Name | 2-methyloct-7-ene-3,4-diol |
|---|---|
| PubChem CID | 103456684 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 2-methyloct-7-ene-3,4-diol |
| SMILES | C=CCCC(O)C(O)C(C)C |
| InChI | InChI=1S/C9H18O2/c1-4-5-6-8(10)9(11)7(2)3/h4,7-11H,1,5-6H2,2-3H3 |
| InChIKey | IWVDEYNNEDQPKB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|