C11H20 — CID 59911119
(4R)-4-propan-2-ylocta-1,7-diene (PubChem CID 59911119) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (4R)-4-propan-2-ylocta-1,7-diene.
| Compound Name | (4R)-4-propan-2-ylocta-1,7-diene |
|---|---|
| PubChem CID | 59911119 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (4R)-4-propan-2-ylocta-1,7-diene |
| SMILES | C=CCC[C@H](CC=C)C(C)C |
| InChI | InChI=1S/C11H20/c1-5-7-9-11(8-6-2)10(3)4/h5-6,10-11H,1-2,7-9H2,3-4H3/t11-/m0/s1 |
| InChIKey | SZMGLHXDCDRAFH-NSHDSACASA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|