About 12-propan-2-yltricosa-1,22-diene
12-propan-2-yltricosa-1,22-diene (PubChem CID 102161324) has the molecular formula C26H50
and a molecular weight of 362.69 g/mol. Its IUPAC name is 12-propan-2-yltricosa-1,22-diene.
Molecular Properties
| Compound Name | 12-propan-2-yltricosa-1,22-diene |
| PubChem CID | 102161324 |
| Molecular Formula | C26H50 |
| Molecular Weight | 362.69 g/mol |
| Exact Mass | 362.39 |
| IUPAC Name | 12-propan-2-yltricosa-1,22-diene |
| SMILES | C=CCCCCCCCCCC(CCCCCCCCCC=C)C(C)C |
| InChI | InChI=1S/C26H50/c1-5-7-9-11-13-15-17-19-21-23-26(25(3)4)24-22-20-18-16-14-12-10-8-6-2/h5-6,25-26H,1-2,7-24H2,3-4H3 |
| InChIKey | UXVCIVDAEZZDGP-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.69 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 12-propan-2-yltricosa-1,22-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-propan-2-yltricosa-1,22-diene?
The IUPAC name of 12-propan-2-yltricosa-1,22-diene (CID 102161324) is 12-propan-2-yltricosa-1,22-diene.
What is the SMILES notation for 12-propan-2-yltricosa-1,22-diene?
The canonical SMILES for 12-propan-2-yltricosa-1,22-diene is C=CCCCCCCCCCC(CCCCCCCCCC=C)C(C)C.
What is the InChIKey of 12-propan-2-yltricosa-1,22-diene?
The InChIKey is UXVCIVDAEZZDGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H50/c1-5-7-9-11-13-15-17-19-21-23-26(25(3)4)24-22-20-18-16-14-12-10-8-6-2/h5-6,25-26H,1-2,7-24H2,3-4H3.
What are the key properties of 12-propan-2-yltricosa-1,22-diene?
12-propan-2-yltricosa-1,22-diene has a molecular weight of 362.69 g/mol, XLogP of 9.65, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 12-propan-2-yltricosa-1,22-diene is sourced from PubChem (CID 102161324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).