About 2-methylundec-10-enal
2-methylundec-10-enal (PubChem CID 547085) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-methylundec-10-enal.
Molecular Properties
| Compound Name | 2-methylundec-10-enal |
| PubChem CID | 547085 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2-methylundec-10-enal |
| SMILES | C=CCCCCCCCC(C)C=O |
| InChI | InChI=1S/C12H22O/c1-3-4-5-6-7-8-9-10-12(2)11-13/h3,11-12H,1,4-10H2,2H3 |
| InChIKey | UWJZCNTXKQOKSA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylundec-10-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylundec-10-enal?
The IUPAC name of 2-methylundec-10-enal (CID 547085) is 2-methylundec-10-enal.
What is the SMILES notation for 2-methylundec-10-enal?
The canonical SMILES for 2-methylundec-10-enal is C=CCCCCCCCC(C)C=O.
What is the InChIKey of 2-methylundec-10-enal?
The InChIKey is UWJZCNTXKQOKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O/c1-3-4-5-6-7-8-9-10-12(2)11-13/h3,11-12H,1,4-10H2,2H3.
What are the key properties of 2-methylundec-10-enal?
2-methylundec-10-enal has a molecular weight of 182.31 g/mol, XLogP of 3.74, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylundec-10-enal is sourced from PubChem (CID 547085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).