About 2-propyldodec-11-enal
2-propyldodec-11-enal (PubChem CID 142653916) has the molecular formula C15H28O
and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-propyldodec-11-enal.
Molecular Properties
| Compound Name | 2-propyldodec-11-enal |
| PubChem CID | 142653916 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 2-propyldodec-11-enal |
| SMILES | C=CCCCCCCCCC(C=O)CCC |
| InChI | InChI=1S/C15H28O/c1-3-5-6-7-8-9-10-11-13-15(14-16)12-4-2/h3,14-15H,1,4-13H2,2H3 |
| InChIKey | HIPAFLMGJKOUSU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-propyldodec-11-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyldodec-11-enal?
The IUPAC name of 2-propyldodec-11-enal (CID 142653916) is 2-propyldodec-11-enal.
What is the SMILES notation for 2-propyldodec-11-enal?
The canonical SMILES for 2-propyldodec-11-enal is C=CCCCCCCCCC(C=O)CCC.
What is the InChIKey of 2-propyldodec-11-enal?
The InChIKey is HIPAFLMGJKOUSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O/c1-3-5-6-7-8-9-10-11-13-15(14-16)12-4-2/h3,14-15H,1,4-13H2,2H3.
What are the key properties of 2-propyldodec-11-enal?
2-propyldodec-11-enal has a molecular weight of 224.39 g/mol, XLogP of 4.91, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyldodec-11-enal is sourced from PubChem (CID 142653916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).