About 2-propylpentanedial
2-propylpentanedial (PubChem CID 86120951) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-propylpentanedial.
Molecular Properties
| Compound Name | 2-propylpentanedial |
| PubChem CID | 86120951 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-propylpentanedial |
| SMILES | CCCC(C=O)CCC=O |
| InChI | InChI=1S/C8H14O2/c1-2-4-8(7-10)5-3-6-9/h6-8H,2-5H2,1H3 |
| InChIKey | KPOWYHWMVHPFCO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-propylpentanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylpentanedial?
The IUPAC name of 2-propylpentanedial (CID 86120951) is 2-propylpentanedial.
What is the SMILES notation for 2-propylpentanedial?
The canonical SMILES for 2-propylpentanedial is CCCC(C=O)CCC=O.
What is the InChIKey of 2-propylpentanedial?
The InChIKey is KPOWYHWMVHPFCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-2-4-8(7-10)5-3-6-9/h6-8H,2-5H2,1H3.
What are the key properties of 2-propylpentanedial?
2-propylpentanedial has a molecular weight of 142.20 g/mol, XLogP of 1.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylpentanedial is sourced from PubChem (CID 86120951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).