About (5R)-6-methyl-2,5-dipropyloctanal
(5R)-6-methyl-2,5-dipropyloctanal (PubChem CID 143527461) has the molecular formula C15H30O
and a molecular weight of 226.40 g/mol. Its IUPAC name is (5R)-6-methyl-2,5-dipropyloctanal.
Molecular Properties
| Compound Name | (5R)-6-methyl-2,5-dipropyloctanal |
| PubChem CID | 143527461 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | (5R)-6-methyl-2,5-dipropyloctanal |
| SMILES | CCCC(C=O)CCC(CCC)C(C)CC |
| InChI | InChI=1S/C15H30O/c1-5-8-14(12-16)10-11-15(9-6-2)13(4)7-3/h12-15H,5-11H2,1-4H3 |
| InChIKey | IDPQAFUGSPBCGZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5R)-6-methyl-2,5-dipropyloctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-6-methyl-2,5-dipropyloctanal?
The IUPAC name of (5R)-6-methyl-2,5-dipropyloctanal (CID 143527461) is (5R)-6-methyl-2,5-dipropyloctanal.
What is the SMILES notation for (5R)-6-methyl-2,5-dipropyloctanal?
The canonical SMILES for (5R)-6-methyl-2,5-dipropyloctanal is CCCC(C=O)CCC(CCC)C(C)CC.
What is the InChIKey of (5R)-6-methyl-2,5-dipropyloctanal?
The InChIKey is IDPQAFUGSPBCGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O/c1-5-8-14(12-16)10-11-15(9-6-2)13(4)7-3/h12-15H,5-11H2,1-4H3.
What are the key properties of (5R)-6-methyl-2,5-dipropyloctanal?
(5R)-6-methyl-2,5-dipropyloctanal has a molecular weight of 226.40 g/mol, XLogP of 4.84, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-6-methyl-2,5-dipropyloctanal is sourced from PubChem (CID 143527461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).