About 9-ethyl-3,8-dimethyl-4-propyldodecane
9-ethyl-3,8-dimethyl-4-propyldodecane (PubChem CID 142338103) has the molecular formula C19H40
and a molecular weight of 268.53 g/mol. Its IUPAC name is 9-ethyl-3,8-dimethyl-4-propyldodecane.
Molecular Properties
| Compound Name | 9-ethyl-3,8-dimethyl-4-propyldodecane |
| PubChem CID | 142338103 |
| Molecular Formula | C19H40 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.31 |
| IUPAC Name | 9-ethyl-3,8-dimethyl-4-propyldodecane |
| SMILES | CCCC(CC)C(C)CCCC(CCC)C(C)CC |
| InChI | InChI=1S/C19H40/c1-7-12-18(10-4)17(6)14-11-15-19(13-8-2)16(5)9-3/h16-19H,7-15H2,1-6H3 |
| InChIKey | RFAAEWIZNBDHOP-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9-ethyl-3,8-dimethyl-4-propyldodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-3,8-dimethyl-4-propyldodecane?
The IUPAC name of 9-ethyl-3,8-dimethyl-4-propyldodecane (CID 142338103) is 9-ethyl-3,8-dimethyl-4-propyldodecane.
What is the SMILES notation for 9-ethyl-3,8-dimethyl-4-propyldodecane?
The canonical SMILES for 9-ethyl-3,8-dimethyl-4-propyldodecane is CCCC(CC)C(C)CCCC(CCC)C(C)CC.
What is the InChIKey of 9-ethyl-3,8-dimethyl-4-propyldodecane?
The InChIKey is RFAAEWIZNBDHOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40/c1-7-12-18(10-4)17(6)14-11-15-19(13-8-2)16(5)9-3/h16-19H,7-15H2,1-6H3.
What are the key properties of 9-ethyl-3,8-dimethyl-4-propyldodecane?
9-ethyl-3,8-dimethyl-4-propyldodecane has a molecular weight of 268.53 g/mol, XLogP of 7.08, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-3,8-dimethyl-4-propyldodecane is sourced from PubChem (CID 142338103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).