C14H30 — CID 57491716
3-ethyl-4,8-dimethyldecane (PubChem CID 57491716) has the molecular formula C14H30 and a molecular weight of 198.39 g/mol. Its IUPAC name is 3-ethyl-4,8-dimethyldecane.
| Compound Name | 3-ethyl-4,8-dimethyldecane |
|---|---|
| PubChem CID | 57491716 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | 3-ethyl-4,8-dimethyldecane |
| SMILES | CCC(C)CCCC(C)C(CC)CC |
| InChI | InChI=1S/C14H30/c1-6-12(4)10-9-11-13(5)14(7-2)8-3/h12-14H,6-11H2,1-5H3 |
| InChIKey | DZTGWRKJMJNVSX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |