About 6-butyl-3,7-dimethylundecane
6-butyl-3,7-dimethylundecane (PubChem CID 123359248) has the molecular formula C17H36
and a molecular weight of 240.47 g/mol. Its IUPAC name is 6-butyl-3,7-dimethylundecane.
Molecular Properties
| Compound Name | 6-butyl-3,7-dimethylundecane |
| PubChem CID | 123359248 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | 6-butyl-3,7-dimethylundecane |
| SMILES | CCCCC(C)C(CCCC)CCC(C)CC |
| InChI | InChI=1S/C17H36/c1-6-9-11-16(5)17(12-10-7-2)14-13-15(4)8-3/h15-17H,6-14H2,1-5H3 |
| InChIKey | PGONWACOPOWVNF-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-butyl-3,7-dimethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-3,7-dimethylundecane?
The IUPAC name of 6-butyl-3,7-dimethylundecane (CID 123359248) is 6-butyl-3,7-dimethylundecane.
What is the SMILES notation for 6-butyl-3,7-dimethylundecane?
The canonical SMILES for 6-butyl-3,7-dimethylundecane is CCCCC(C)C(CCCC)CCC(C)CC.
What is the InChIKey of 6-butyl-3,7-dimethylundecane?
The InChIKey is PGONWACOPOWVNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36/c1-6-9-11-16(5)17(12-10-7-2)14-13-15(4)8-3/h15-17H,6-14H2,1-5H3.
What are the key properties of 6-butyl-3,7-dimethylundecane?
6-butyl-3,7-dimethylundecane has a molecular weight of 240.47 g/mol, XLogP of 6.45, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-3,7-dimethylundecane is sourced from PubChem (CID 123359248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).